C10H14N4 — CID 142229046
4-N,4-N-dimethyl-8,8a-dihydroquinazoline-2,4-diamine (PubChem CID 142229046) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-8,8a-dihydroquinazoline-2,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-8,8a-dihydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142229046 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-N,4-N-dimethyl-8,8a-dihydroquinazoline-2,4-diamine |
| SMILES | CN(C)C1=NC(N)=NC2CC=CC=C12 |
| InChI | InChI=1S/C10H14N4/c1-14(2)9-7-5-3-4-6-8(7)12-10(11)13-9/h3-5,8H,6H2,1-2H3,(H2,11,12) |
| InChIKey | MRKSWTZNEMWPNV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |