C28H42N4 — CID 145439319
4-N-[4-[hexa-1,5-dien-2-yl(methyl)amino]butyl]-4-N-hex-1-en-2-yl-3-methyl-7-methylidene-6H-quinoline-2,4-diamine (PubChem CID 145439319) has the molecular formula C28H42N4 and a molecular weight of 434.67 g/mol. Its IUPAC name is 4-N-[4-[hexa-1,5-dien-2-yl(methyl)amino]butyl]-4-N-hex-1-en-2-yl-3-methyl-7-methylidene-6H-quinoline-2,4-diamine.
| Compound Name | 4-N-[4-[hexa-1,5-dien-2-yl(methyl)amino]butyl]-4-N-hex-1-en-2-yl-3-methyl-7-methylidene-6H-quinoline-2,4-diamine |
|---|---|
| PubChem CID | 145439319 |
| Molecular Formula | C28H42N4 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 4-N-[4-[hexa-1,5-dien-2-yl(methyl)amino]butyl]-4-N-hex-1-en-2-yl-3-methyl-7-methylidene-6H-quinoline-2,4-diamine |
| SMILES | C=CCCC(=C)N(C)CCCCN(C(=C)CCCC)c1c(C)c(N)nc2c1=CCC(=C)C=2 |
| InChI | InChI=1S/C28H42N4/c1-8-10-14-22(4)31(7)18-12-13-19-32(23(5)15-11-9-2)27-24(6)28(29)30-26-20-21(3)16-17-25(26)27/h8,17,20H,1,3-5,9-16,18-19H2,2,6-7H3,(H2,29,30) |
| InChIKey | ZCDXXEDMEZCIRL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|