C16H26N6 — CID 163856056
2-[amino-(3-aminocyclohexa-1,3-dien-1-yl)methylidene]-1-N'-tert-butyl-3-N'-ethenylpropanediimidamide (PubChem CID 163856056) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is 2-[amino-(3-aminocyclohexa-1,3-dien-1-yl)methylidene]-1-N'-tert-butyl-3-N'-ethenylpropanediimidamide.
| Compound Name | 2-[amino-(3-aminocyclohexa-1,3-dien-1-yl)methylidene]-1-N'-tert-butyl-3-N'-ethenylpropanediimidamide |
|---|---|
| PubChem CID | 163856056 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-[amino-(3-aminocyclohexa-1,3-dien-1-yl)methylidene]-1-N'-tert-butyl-3-N'-ethenylpropanediimidamide |
| SMILES | C=C/N=C(\N)C(=C(N)C1=CC(N)=CCC1)/C(N)=N/C(C)(C)C |
| InChI | InChI=1S/C16H26N6/c1-5-21-14(19)12(15(20)22-16(2,3)4)13(18)10-7-6-8-11(17)9-10/h5,8-9H,1,6-7,17-18H2,2-4H3,(H2,19,21)(H2,20,22) |
| InChIKey | ZYWDHXSGJWVUPB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|