C17H25N3 — CID 155747111
(1Z)-1-[1-ethyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imino-6-methylidenepiperidin-3-ylidene]ethanamine (PubChem CID 155747111) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is (1Z)-1-[1-ethyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imino-6-methylidenepiperidin-3-ylidene]ethanamine.
| Compound Name | (1Z)-1-[1-ethyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imino-6-methylidenepiperidin-3-ylidene]ethanamine |
|---|---|
| PubChem CID | 155747111 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | (1Z)-1-[1-ethyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imino-6-methylidenepiperidin-3-ylidene]ethanamine |
| SMILES | C=C/C=C(\C=C/C)/N=C1C(=C(/C)N)/CCC(=C)N/1CC |
| InChI | InChI=1S/C17H25N3/c1-6-9-15(10-7-2)19-17-16(14(5)18)12-11-13(4)20(17)8-3/h6-7,9-10H,1,4,8,11-12,18H2,2-3,5H3/b10-7-,15-9+,16-14-,19-17- |
| InChIKey | HSRPXLJNQOCZHW-YXPDTQDESA-N |
| XLogP | 3.89 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|