C10H14N4 — CID 136623492
4-methyl-1,4,6,7-tetrahydroquinazoline-8-carboximidamide (PubChem CID 136623492) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-methyl-1,4,6,7-tetrahydroquinazoline-8-carboximidamide.
| Compound Name | 4-methyl-1,4,6,7-tetrahydroquinazoline-8-carboximidamide |
|---|---|
| PubChem CID | 136623492 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-methyl-1,4,6,7-tetrahydroquinazoline-8-carboximidamide |
| SMILES | [H]/N=C(\N)C1=C2NC=NC(C)C2=CCC1 |
| InChI | InChI=1S/C10H14N4/c1-6-7-3-2-4-8(10(11)12)9(7)14-5-13-6/h3,5-6H,2,4H2,1H3,(H3,11,12)(H,13,14) |
| InChIKey | HCUSALLYNSHGCT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|