C14H21N3 — CID 142229546
(5Z)-5-[(Z)-but-2-enylidene]-4-ethenyl-N,N,2-trimethyl-4,6-dihydro-1,3-diazepin-7-amine (PubChem CID 142229546) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (5Z)-5-[(Z)-but-2-enylidene]-4-ethenyl-N,N,2-trimethyl-4,6-dihydro-1,3-diazepin-7-amine.
| Compound Name | (5Z)-5-[(Z)-but-2-enylidene]-4-ethenyl-N,N,2-trimethyl-4,6-dihydro-1,3-diazepin-7-amine |
|---|---|
| PubChem CID | 142229546 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (5Z)-5-[(Z)-but-2-enylidene]-4-ethenyl-N,N,2-trimethyl-4,6-dihydro-1,3-diazepin-7-amine |
| SMILES | C=CC1N=C(C)N=C(N(C)C)C/C1=C/C=C\C |
| InChI | InChI=1S/C14H21N3/c1-6-8-9-12-10-14(17(4)5)16-11(3)15-13(12)7-2/h6-9,13H,2,10H2,1,3-5H3/b8-6-,12-9- |
| InChIKey | MKMJSNPURWDOSQ-VOZBMUDTSA-N |
| XLogP | 2.83 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|