About (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole
(5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole (PubChem CID 163913102) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole.
Analyze (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole?
The IUPAC name of (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole (CID 163913102) is (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole.
What is the SMILES notation for (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole?
The canonical SMILES for (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole is C=C/C=C1/N=CN(C)C1C.
What is the InChIKey of (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole?
The InChIKey is QTXASRDTEBUKQS-VMPITWQZSA-N. The full InChI is InChI=1S/C8H12N2/c1-4-5-8-7(2)10(3)6-9-8/h4-7H,1H2,2-3H3/b8-5+.
What are the key properties of (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole?
(5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole has a molecular weight of 136.20 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3,4-dimethyl-5-prop-2-enylidene-4H-imidazole is sourced from PubChem (CID 163913102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).