C11H18N2 — CID 146035529
(2R)-1-(2,3,7,7a-tetrahydro-1H-indol-3-yl)propan-2-amine (PubChem CID 146035529) has the molecular formula C11H18N2 and a molecular weight of 178.27 g/mol. Its IUPAC name is (2R)-1-(2,3,7,7a-tetrahydro-1H-indol-3-yl)propan-2-amine.
| Compound Name | (2R)-1-(2,3,7,7a-tetrahydro-1H-indol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 146035529 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (2R)-1-(2,3,7,7a-tetrahydro-1H-indol-3-yl)propan-2-amine |
| SMILES | C[C@H](CC1CNC2C1=CC=CC2)N |
| InChI | InChI=1S/C11H18N2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-4,8-9,11,13H,5-7,12H2,1H3/t8-,9?,11?/m1/s1 |
| InChIKey | GLOGXFIUNBZUDB-FKTRJACZSA-N |
| XLogP | 0.50 |
| TPSA | 38.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 242 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |