C48H42N6O6 — CID 146036776
1-[4-[[4,6-bis[4-[(4-ethoxyphenyl)iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-(4-ethoxyphenyl)methanimine (PubChem CID 146036776) has the molecular formula C48H42N6O6 and a molecular weight of 798.90 g/mol. Its IUPAC name is 1-[4-[[4,6-bis[4-[(4-ethoxyphenyl)iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-[4-[[4,6-bis[4-[(4-ethoxyphenyl)iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 146036776 |
| Molecular Formula | C48H42N6O6 |
| Molecular Weight | 798.90 g/mol |
| Exact Mass | 798.32 |
| IUPAC Name | 1-[4-[[4,6-bis[4-[(4-ethoxyphenyl)iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2ccc(Oc3nc(Oc4ccc(/C=N/c5ccc(OCC)cc5)cc4)nc(Oc4ccc(/C=N/c5ccc(OCC)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C48H42N6O6/c1-4-55-40-25-13-37(14-26-40)49-31-34-7-19-43(20-8-34)58-46-52-47(59-44-21-9-35(10-22-44)32-50-38-15-27-41(28-16-38)56-5-2)54-48(53-46)60-45-23-11-36(12-24-45)33-51-39-17-29-42(30-18-39)57-6-3/h7-33H,4-6H2,1-3H3/b49-31+,50-32+,51-33+ |
| InChIKey | APVPVDNKIATIEM-HEOGIFHKSA-N |
| XLogP | 11.70 |
| TPSA | 131.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.90 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|