C51H54N6O6Si3 — CID 10396053
1-[4-[[4,6-bis[4-[[4-[methoxy(dimethyl)silyl]phenyl]iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-[4-[methoxy(dimethyl)silyl]phenyl]methanimine (PubChem CID 10396053) has the molecular formula C51H54N6O6Si3 and a molecular weight of 931.29 g/mol. Its IUPAC name is 1-[4-[[4,6-bis[4-[[4-[methoxy(dimethyl)silyl]phenyl]iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-[4-[methoxy(dimethyl)silyl]phenyl]methanimine.
| Compound Name | 1-[4-[[4,6-bis[4-[[4-[methoxy(dimethyl)silyl]phenyl]iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-[4-[methoxy(dimethyl)silyl]phenyl]methanimine |
|---|---|
| PubChem CID | 10396053 |
| Molecular Formula | C51H54N6O6Si3 |
| Molecular Weight | 931.29 g/mol |
| Exact Mass | 930.34 |
| IUPAC Name | 1-[4-[[4,6-bis[4-[[4-[methoxy(dimethyl)silyl]phenyl]iminomethyl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]-N-[4-[methoxy(dimethyl)silyl]phenyl]methanimine |
| SMILES | CO[Si](C)(C)c1ccc(/N=C/c2ccc(Oc3nc(Oc4ccc(/C=N/c5ccc([Si](C)(C)OC)cc5)cc4)nc(Oc4ccc(/C=N/c5ccc([Si](C)(C)OC)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C51H54N6O6Si3/c1-58-64(4,5)46-28-16-40(17-29-46)52-34-37-10-22-43(23-11-37)61-49-55-50(62-44-24-12-38(13-25-44)35-53-41-18-30-47(31-19-41)65(6,7)59-2)57-51(56-49)63-45-26-14-39(15-27-45)36-54-42-20-32-48(33-21-42)66(8,9)60-3/h10-36H,1-9H3/b52-34+,53-35+,54-36+ |
| InChIKey | ZFBNJFNOSDJXNP-AJEAHFMYSA-N |
| XLogP | 10.68 |
| TPSA | 131.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.29 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|