C13H14N8 — CID 146038817
6-(4-pyrazin-2-ylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 146038817) has the molecular formula C13H14N8 and a molecular weight of 282.31 g/mol. Its IUPAC name is 6-(4-pyrazin-2-ylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine.
| Compound Name | 6-(4-pyrazin-2-ylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 146038817 |
| Molecular Formula | C13H14N8 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 6-(4-pyrazin-2-ylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | c1cnc(N2CCN(c3ncc4cn[nH]c4n3)CC2)cn1 |
| InChI | InChI=1S/C13H14N8/c1-2-15-11(9-14-1)20-3-5-21(6-4-20)13-16-7-10-8-17-19-12(10)18-13/h1-2,7-9H,3-6H2,(H,16,17,18,19) |
| InChIKey | KXULMQATTSCAOG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |