C17H24N6O3S — CID 146039350
N-[(1R,3R)-3-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]-2H-triazole-4-carboxamide (PubChem CID 146039350) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[(1R,3R)-3-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[(1R,3R)-3-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 146039350 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[(1R,3R)-3-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]-2H-triazole-4-carboxamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)N[C@@H]1CCC[C@@H](NC(=O)c2cn[nH]n2)C1 |
| InChI | InChI=1S/C17H24N6O3S/c1-23(12-13-6-3-2-4-7-13)27(25,26)21-15-9-5-8-14(10-15)19-17(24)16-11-18-22-20-16/h2-4,6-7,11,14-15,21H,5,8-10,12H2,1H3,(H,19,24)(H,18,20,22)/t14-,15-/m1/s1 |
| InChIKey | BDCNDTNKVJYZHS-HUUCEWRRSA-N |
| XLogP | 0.81 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |