C18H24N4O2S2 — CID 175640501
2-[4-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]sulfanylpyrimidine (PubChem CID 175640501) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[4-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]sulfanylpyrimidine.
| Compound Name | 2-[4-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]sulfanylpyrimidine |
|---|---|
| PubChem CID | 175640501 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[4-[[benzyl(methyl)sulfamoyl]amino]cyclohexyl]sulfanylpyrimidine |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)NC1CCC(Sc2ncccn2)CC1 |
| InChI | InChI=1S/C18H24N4O2S2/c1-22(14-15-6-3-2-4-7-15)26(23,24)21-16-8-10-17(11-9-16)25-18-19-12-5-13-20-18/h2-7,12-13,16-17,21H,8-11,14H2,1H3 |
| InChIKey | ZTPGUHNCQWFBEV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |