C13H15N9O — CID 146042205
N-[3-(pyridin-3-ylamino)propyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide (PubChem CID 146042205) has the molecular formula C13H15N9O and a molecular weight of 313.32 g/mol. Its IUPAC name is N-[3-(pyridin-3-ylamino)propyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(pyridin-3-ylamino)propyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 146042205 |
| Molecular Formula | C13H15N9O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[3-(pyridin-3-ylamino)propyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCCNc1cccnc1)c1cc(-n2cnnn2)n[nH]1 |
| InChI | InChI=1S/C13H15N9O/c23-13(11-7-12(19-18-11)22-9-17-20-21-22)16-6-2-5-15-10-3-1-4-14-8-10/h1,3-4,7-9,15H,2,5-6H2,(H,16,23)(H,18,19) |
| InChIKey | NUQSKCHAXYJMIA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|