C16H22N10O — CID 146041003
N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide (PubChem CID 146041003) has the molecular formula C16H22N10O and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 146041003 |
| Molecular Formula | C16H22N10O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]-3-(tetrazol-1-yl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCCc1nc(C)cc(NCCNC(=O)c2cc(-n3cnnn3)n[nH]2)n1 |
| InChI | InChI=1S/C16H22N10O/c1-3-4-5-13-20-11(2)8-14(21-13)17-6-7-18-16(27)12-9-15(23-22-12)26-10-19-24-25-26/h8-10H,3-7H2,1-2H3,(H,18,27)(H,22,23)(H,17,20,21) |
| InChIKey | UUERHECCHYUYJS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|