C14H20N4O2 — CID 50958764
1-[2-[(6-methyl-2-propylpyrimidin-4-yl)amino]ethyl]pyrrolidine-2,5-dione (PubChem CID 50958764) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-[2-[(6-methyl-2-propylpyrimidin-4-yl)amino]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[(6-methyl-2-propylpyrimidin-4-yl)amino]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 50958764 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[2-[(6-methyl-2-propylpyrimidin-4-yl)amino]ethyl]pyrrolidine-2,5-dione |
| SMILES | CCCc1nc(C)cc(NCCN2C(=O)CCC2=O)n1 |
| InChI | InChI=1S/C14H20N4O2/c1-3-4-11-16-10(2)9-12(17-11)15-7-8-18-13(19)5-6-14(18)20/h9H,3-8H2,1-2H3,(H,15,16,17) |
| InChIKey | JYWHQOXKRQZTMN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|