C12H17N5O2 — CID 80655042
3-[[4-methyl-6-(propylamino)pyrimidin-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 80655042) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[[4-methyl-6-(propylamino)pyrimidin-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[4-methyl-6-(propylamino)pyrimidin-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 80655042 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[[4-methyl-6-(propylamino)pyrimidin-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CCCNc1cc(C)nc(CN2C(=O)CNC2=O)n1 |
| InChI | InChI=1S/C12H17N5O2/c1-3-4-13-9-5-8(2)15-10(16-9)7-17-11(18)6-14-12(17)19/h5H,3-4,6-7H2,1-2H3,(H,14,19)(H,13,15,16) |
| InChIKey | KOXVTYIUXSAELX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|