C13H15N5O2S — CID 62209192
3-[[4-(propylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 62209192) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[[4-(propylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[4-(propylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 62209192 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[[4-(propylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CCCNc1nc(CN2C(=O)CNC2=O)nc2sccc12 |
| InChI | InChI=1S/C13H15N5O2S/c1-2-4-14-11-8-3-5-21-12(8)17-9(16-11)7-18-10(19)6-15-13(18)20/h3,5H,2,4,6-7H2,1H3,(H,15,20)(H,14,16,17) |
| InChIKey | MPGPTLCAQBDXQI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|