C16H19FN2O2 — CID 146042373
1-[(3S,4R)-4-ethoxyoxolan-3-yl]-2-(4-fluoro-2-methylphenyl)imidazole (PubChem CID 146042373) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-2-(4-fluoro-2-methylphenyl)imidazole.
| Compound Name | 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-2-(4-fluoro-2-methylphenyl)imidazole |
|---|---|
| PubChem CID | 146042373 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-2-(4-fluoro-2-methylphenyl)imidazole |
| SMILES | CCO[C@H]1COC[C@@H]1n1ccnc1-c1ccc(F)cc1C |
| InChI | InChI=1S/C16H19FN2O2/c1-3-21-15-10-20-9-14(15)19-7-6-18-16(19)13-5-4-12(17)8-11(13)2/h4-8,14-15H,3,9-10H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | JCHCAGIZBKRTKL-GJZGRUSLSA-N |
| XLogP | 2.97 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |