C14H14F2N2O2 — CID 154823286
2-(2,4-difluorophenyl)-1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazole (PubChem CID 154823286) has the molecular formula C14H14F2N2O2 and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazole.
| Compound Name | 2-(2,4-difluorophenyl)-1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazole |
|---|---|
| PubChem CID | 154823286 |
| Molecular Formula | C14H14F2N2O2 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazole |
| SMILES | CO[C@H]1COC[C@H]1n1ccnc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C14H14F2N2O2/c1-19-13-8-20-7-12(13)18-5-4-17-14(18)10-3-2-9(15)6-11(10)16/h2-6,12-13H,7-8H2,1H3/t12-,13+/m1/s1 |
| InChIKey | QOJHQVZKQDMQOQ-OLZOCXBDSA-N |
| XLogP | 2.41 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |