C18H22N4O — CID 146042664
N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-3-(1,2,4-triazol-4-yl)benzamide (PubChem CID 146042664) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-3-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-3-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 146042664 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-3-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(NC[C@H]1CC[C@@H]2CCC[C@@H]21)c1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C18H22N4O/c23-18(19-10-15-8-7-13-3-2-6-17(13)15)14-4-1-5-16(9-14)22-11-20-21-12-22/h1,4-5,9,11-13,15,17H,2-3,6-8,10H2,(H,19,23)/t13-,15+,17-/m0/s1 |
| InChIKey | HUUQSABQXMGKLZ-LXZKKBNFSA-N |
| XLogP | 2.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |