C17H27N3O — CID 146043233
N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-5-methyl-1-propylpyrazole-4-carboxamide (PubChem CID 146043233) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-5-methyl-1-propylpyrazole-4-carboxamide.
| Compound Name | N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-5-methyl-1-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146043233 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]methyl]-5-methyl-1-propylpyrazole-4-carboxamide |
| SMILES | CCCn1ncc(C(=O)NC[C@H]2CC[C@@H]3CCC[C@@H]32)c1C |
| InChI | InChI=1S/C17H27N3O/c1-3-9-20-12(2)16(11-19-20)17(21)18-10-14-8-7-13-5-4-6-15(13)14/h11,13-15H,3-10H2,1-2H3,(H,18,21)/t13-,14+,15-/m0/s1 |
| InChIKey | XLHVXXXHFYBDTQ-ZNMIVQPWSA-N |
| XLogP | 3.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |