C26H32N4O5 — CID 146045348
17-methyl-10-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-2-oxa-5,10,13-triazabicyclo[13.4.0]nonadeca-1(15),16,18-triene-6,14-dione (PubChem CID 146045348) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 17-methyl-10-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-2-oxa-5,10,13-triazabicyclo[13.4.0]nonadeca-1(15),16,18-triene-6,14-dione.
| Compound Name | 17-methyl-10-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-2-oxa-5,10,13-triazabicyclo[13.4.0]nonadeca-1(15),16,18-triene-6,14-dione |
|---|---|
| PubChem CID | 146045348 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 17-methyl-10-(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)-2-oxa-5,10,13-triazabicyclo[13.4.0]nonadeca-1(15),16,18-triene-6,14-dione |
| SMILES | Cc1ccc2c(c1)C(=O)NCCN(C(=O)c1[nH]c3c(c1C)C(=O)CCC3)CCCC(=O)NCCO2 |
| InChI | InChI=1S/C26H32N4O5/c1-16-8-9-21-18(15-16)25(33)28-10-13-30(12-4-7-22(32)27-11-14-35-21)26(34)24-17(2)23-19(29-24)5-3-6-20(23)31/h8-9,15,29H,3-7,10-14H2,1-2H3,(H,27,32)(H,28,33) |
| InChIKey | NFELPKWVBYTXGZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |