C22H26FN5O — CID 146047553
2-fluoro-4-[[5-(2-methoxy-4-piperidin-4-ylphenyl)pyrazolidin-3-yl]amino]benzonitrile (PubChem CID 146047553) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-fluoro-4-[[5-(2-methoxy-4-piperidin-4-ylphenyl)pyrazolidin-3-yl]amino]benzonitrile.
| Compound Name | 2-fluoro-4-[[5-(2-methoxy-4-piperidin-4-ylphenyl)pyrazolidin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 146047553 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-fluoro-4-[[5-(2-methoxy-4-piperidin-4-ylphenyl)pyrazolidin-3-yl]amino]benzonitrile |
| SMILES | COc1cc(C2CCNCC2)ccc1C1CC(Nc2ccc(C#N)c(F)c2)NN1 |
| InChI | InChI=1S/C22H26FN5O/c1-29-21-10-15(14-6-8-25-9-7-14)3-5-18(21)20-12-22(28-27-20)26-17-4-2-16(13-24)19(23)11-17/h2-5,10-11,14,20,22,25-28H,6-9,12H2,1H3 |
| InChIKey | PITBYMHGJIJVIR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |