C14H18ClN3O2S — CID 146048642
2-[2-(dimethylamino)ethylsulfanyl]-4-hydroxy-5-phenyl-1H-pyrimidin-6-one;hydrochloride (PubChem CID 146048642) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylsulfanyl]-4-hydroxy-5-phenyl-1H-pyrimidin-6-one;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethylsulfanyl]-4-hydroxy-5-phenyl-1H-pyrimidin-6-one;hydrochloride |
|---|---|
| PubChem CID | 146048642 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[2-(dimethylamino)ethylsulfanyl]-4-hydroxy-5-phenyl-1H-pyrimidin-6-one;hydrochloride |
| SMILES | CN(C)CCSc1nc(O)c(-c2ccccc2)c(=O)[nH]1.Cl |
| InChI | InChI=1S/C14H17N3O2S.ClH/c1-17(2)8-9-20-14-15-12(18)11(13(19)16-14)10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3,(H2,15,16,18,19);1H |
| InChIKey | SWJMWWPYAGFZOT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |