C15H28ClN3O2S — CID 16682155
2-[2-(dimethylamino)ethylsulfanyl]-5-heptyl-4-hydroxy-1H-pyrimidin-6-one;hydrochloride (PubChem CID 16682155) has the molecular formula C15H28ClN3O2S and a molecular weight of 349.93 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylsulfanyl]-5-heptyl-4-hydroxy-1H-pyrimidin-6-one;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethylsulfanyl]-5-heptyl-4-hydroxy-1H-pyrimidin-6-one;hydrochloride |
|---|---|
| PubChem CID | 16682155 |
| Molecular Formula | C15H28ClN3O2S |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[2-(dimethylamino)ethylsulfanyl]-5-heptyl-4-hydroxy-1H-pyrimidin-6-one;hydrochloride |
| SMILES | CCCCCCCc1c(O)nc(SCCN(C)C)[nH]c1=O.Cl |
| InChI | InChI=1S/C15H27N3O2S.ClH/c1-4-5-6-7-8-9-12-13(19)16-15(17-14(12)20)21-11-10-18(2)3;/h4-11H2,1-3H3,(H2,16,17,19,20);1H |
| InChIKey | BYCNWJPZSBSKJU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|