C16H26N4O5 — CID 146050858
N-[3-[3-(dimethylamino)propylamino]propyl]pyridine-4-carboxamide;oxalic acid (PubChem CID 146050858) has the molecular formula C16H26N4O5 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[3-[3-(dimethylamino)propylamino]propyl]pyridine-4-carboxamide;oxalic acid.
| Compound Name | N-[3-[3-(dimethylamino)propylamino]propyl]pyridine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 146050858 |
| Molecular Formula | C16H26N4O5 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[3-[3-(dimethylamino)propylamino]propyl]pyridine-4-carboxamide;oxalic acid |
| SMILES | CN(C)CCCNCCCNC(=O)c1ccncc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H24N4O.C2H2O4/c1-18(2)12-4-8-15-7-3-9-17-14(19)13-5-10-16-11-6-13;3-1(4)2(5)6/h5-6,10-11,15H,3-4,7-9,12H2,1-2H3,(H,17,19);(H,3,4)(H,5,6) |
| InChIKey | DRZJIEJKMDCMHL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|