C19H19ClF3N5O3 — CID 146060399
2-ethyl-8-oxo-N-[4-(trifluoromethoxy)phenyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide;hydrochloride (PubChem CID 146060399) has the molecular formula C19H19ClF3N5O3 and a molecular weight of 457.84 g/mol. Its IUPAC name is 2-ethyl-8-oxo-N-[4-(trifluoromethoxy)phenyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide;hydrochloride.
| Compound Name | 2-ethyl-8-oxo-N-[4-(trifluoromethoxy)phenyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146060399 |
| Molecular Formula | C19H19ClF3N5O3 |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-ethyl-8-oxo-N-[4-(trifluoromethoxy)phenyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide;hydrochloride |
| SMILES | CCn1c2c(c(=O)n3ncc(C(=O)Nc4ccc(OC(F)(F)F)cc4)c13)CNCC2.Cl |
| InChI | InChI=1S/C19H18F3N5O3.ClH/c1-2-26-15-7-8-23-9-13(15)18(29)27-17(26)14(10-24-27)16(28)25-11-3-5-12(6-4-11)30-19(20,21)22;/h3-6,10,23H,2,7-9H2,1H3,(H,25,28);1H |
| InChIKey | JTFFKKSJPCWHBV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |