C17H15F3N2O6 — CID 174744009
6-(2-methoxyethoxy)-5-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyridine-3-carboxylic acid (PubChem CID 174744009) has the molecular formula C17H15F3N2O6 and a molecular weight of 400.31 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-5-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 6-(2-methoxyethoxy)-5-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174744009 |
| Molecular Formula | C17H15F3N2O6 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 6-(2-methoxyethoxy)-5-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyridine-3-carboxylic acid |
| SMILES | COCCOc1ncc(C(=O)O)cc1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3N2O6/c1-26-6-7-27-15-13(8-10(9-21-15)16(24)25)14(23)22-11-2-4-12(5-3-11)28-17(18,19)20/h2-5,8-9H,6-7H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | YHWCUNXWHPVVAE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|