C26H29ClF3N3O6 — CID 146062803
1-[4-[(2-chlorobenzoyl)amino]benzoyl]-N-(3-methoxypropyl)piperidine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062803) has the molecular formula C26H29ClF3N3O6 and a molecular weight of 571.98 g/mol. Its IUPAC name is 1-[4-[(2-chlorobenzoyl)amino]benzoyl]-N-(3-methoxypropyl)piperidine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[(2-chlorobenzoyl)amino]benzoyl]-N-(3-methoxypropyl)piperidine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062803 |
| Molecular Formula | C26H29ClF3N3O6 |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 1-[4-[(2-chlorobenzoyl)amino]benzoyl]-N-(3-methoxypropyl)piperidine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCCNC(=O)C1CCCN(C(=O)c2ccc(NC(=O)c3ccccc3Cl)cc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H28ClN3O4.C2HF3O2/c1-32-15-5-13-26-22(29)18-6-4-14-28(16-18)24(31)17-9-11-19(12-10-17)27-23(30)20-7-2-3-8-21(20)25;3-2(4,5)1(6)7/h2-3,7-12,18H,4-6,13-16H2,1H3,(H,26,29)(H,27,30);(H,6,7) |
| InChIKey | MTHMVLUEUKKATQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|