C24H28ClN3O3 — CID 92729025
(3R)-N-butyl-1-[4-[(2-chlorobenzoyl)amino]benzoyl]piperidine-3-carboxamide (PubChem CID 92729025) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is (3R)-N-butyl-1-[4-[(2-chlorobenzoyl)amino]benzoyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-butyl-1-[4-[(2-chlorobenzoyl)amino]benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92729025 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (3R)-N-butyl-1-[4-[(2-chlorobenzoyl)amino]benzoyl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN(C(=O)c2ccc(NC(=O)c3ccccc3Cl)cc2)C1 |
| InChI | InChI=1S/C24H28ClN3O3/c1-2-3-14-26-22(29)18-7-6-15-28(16-18)24(31)17-10-12-19(13-11-17)27-23(30)20-8-4-5-9-21(20)25/h4-5,8-13,18H,2-3,6-7,14-16H2,1H3,(H,26,29)(H,27,30)/t18-/m1/s1 |
| InChIKey | SRAXKZHNGVBWFJ-GOSISDBHSA-N |
| XLogP | 4.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|