C19H20ClN3O3 — CID 146063594
propan-2-yl 4-(4-hydroxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride (PubChem CID 146063594) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is propan-2-yl 4-(4-hydroxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride.
| Compound Name | propan-2-yl 4-(4-hydroxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 146063594 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | propan-2-yl 4-(4-hydroxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride |
| SMILES | Cc1ccc2c(Nc3ccc(O)cc3)c(C(=O)OC(C)C)cnc2n1.Cl |
| InChI | InChI=1S/C19H19N3O3.ClH/c1-11(2)25-19(24)16-10-20-18-15(9-4-12(3)21-18)17(16)22-13-5-7-14(23)8-6-13;/h4-11,23H,1-3H3,(H,20,21,22);1H |
| InChIKey | WYASKJYMPWNIJG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|