C19H19ClIN3O2 — CID 146063615
propan-2-yl 4-(4-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride (PubChem CID 146063615) has the molecular formula C19H19ClIN3O2 and a molecular weight of 483.74 g/mol. Its IUPAC name is propan-2-yl 4-(4-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride.
| Compound Name | propan-2-yl 4-(4-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 146063615 |
| Molecular Formula | C19H19ClIN3O2 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | propan-2-yl 4-(4-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate;hydrochloride |
| SMILES | Cc1ccc2c(Nc3ccc(I)cc3)c(C(=O)OC(C)C)cnc2n1.Cl |
| InChI | InChI=1S/C19H18IN3O2.ClH/c1-11(2)25-19(24)16-10-21-18-15(9-4-12(3)22-18)17(16)23-14-7-5-13(20)6-8-14;/h4-11H,1-3H3,(H,21,22,23);1H |
| InChIKey | HDCJJOKIPBALPC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|