C22H24ClIN4O — CID 146064100
[4-(4-iodoanilino)-7-methyl-1,8-naphthyridin-3-yl]-(2-methylpiperidin-1-yl)methanone;hydrochloride (PubChem CID 146064100) has the molecular formula C22H24ClIN4O and a molecular weight of 522.82 g/mol. Its IUPAC name is [4-(4-iodoanilino)-7-methyl-1,8-naphthyridin-3-yl]-(2-methylpiperidin-1-yl)methanone;hydrochloride.
| Compound Name | [4-(4-iodoanilino)-7-methyl-1,8-naphthyridin-3-yl]-(2-methylpiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 146064100 |
| Molecular Formula | C22H24ClIN4O |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | [4-(4-iodoanilino)-7-methyl-1,8-naphthyridin-3-yl]-(2-methylpiperidin-1-yl)methanone;hydrochloride |
| SMILES | Cc1ccc2c(Nc3ccc(I)cc3)c(C(=O)N3CCCCC3C)cnc2n1.Cl |
| InChI | InChI=1S/C22H23IN4O.ClH/c1-14-6-11-18-20(26-17-9-7-16(23)8-10-17)19(13-24-21(18)25-14)22(28)27-12-4-3-5-15(27)2;/h6-11,13,15H,3-5,12H2,1-2H3,(H,24,25,26);1H |
| InChIKey | LPWGPBHWYMKOQN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|