C11H16Cl2N4 — CID 146064771
2-(5-methyl-2-pyridin-3-ylimidazol-1-yl)ethanamine;dihydrochloride (PubChem CID 146064771) has the molecular formula C11H16Cl2N4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 2-(5-methyl-2-pyridin-3-ylimidazol-1-yl)ethanamine;dihydrochloride.
| Compound Name | 2-(5-methyl-2-pyridin-3-ylimidazol-1-yl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 146064771 |
| Molecular Formula | C11H16Cl2N4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(5-methyl-2-pyridin-3-ylimidazol-1-yl)ethanamine;dihydrochloride |
| SMILES | Cc1cnc(-c2cccnc2)n1CCN.Cl.Cl |
| InChI | InChI=1S/C11H14N4.2ClH/c1-9-7-14-11(15(9)6-4-12)10-3-2-5-13-8-10;;/h2-3,5,7-8H,4,6,12H2,1H3;2*1H |
| InChIKey | PTDZOCJWZFHZSK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |