C14H12Cl2N4 — CID 94749231
2-(5,6-dichloro-2-pyridin-3-ylbenzimidazol-1-yl)ethanamine (PubChem CID 94749231) has the molecular formula C14H12Cl2N4 and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-(5,6-dichloro-2-pyridin-3-ylbenzimidazol-1-yl)ethanamine.
| Compound Name | 2-(5,6-dichloro-2-pyridin-3-ylbenzimidazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 94749231 |
| Molecular Formula | C14H12Cl2N4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-(5,6-dichloro-2-pyridin-3-ylbenzimidazol-1-yl)ethanamine |
| SMILES | NCCn1c(-c2cccnc2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C14H12Cl2N4/c15-10-6-12-13(7-11(10)16)20(5-3-17)14(19-12)9-2-1-4-18-8-9/h1-2,4,6-8H,3,5,17H2 |
| InChIKey | HENJVXSYAAKFHD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |