C17H28ClN3O3 — CID 146065227
N-(3-morpholin-4-ylpropyl)-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride (PubChem CID 146065227) has the molecular formula C17H28ClN3O3 and a molecular weight of 357.88 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride.
| Compound Name | N-(3-morpholin-4-ylpropyl)-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146065227 |
| Molecular Formula | C17H28ClN3O3 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(c1ccco1)N(CCCN1CCOCC1)C1CCCNC1 |
| InChI | InChI=1S/C17H27N3O3.ClH/c21-17(16-5-2-11-23-16)20(15-4-1-6-18-14-15)8-3-7-19-9-12-22-13-10-19;/h2,5,11,15,18H,1,3-4,6-10,12-14H2;1H |
| InChIKey | YDVYOOOGGITLGC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |