C20H33ClN4O — CID 146065182
3-(2-phenylethyl)-1-piperidin-3-yl-1-(2-pyrrolidin-1-ylethyl)urea;hydrochloride (PubChem CID 146065182) has the molecular formula C20H33ClN4O and a molecular weight of 380.96 g/mol. Its IUPAC name is 3-(2-phenylethyl)-1-piperidin-3-yl-1-(2-pyrrolidin-1-ylethyl)urea;hydrochloride.
| Compound Name | 3-(2-phenylethyl)-1-piperidin-3-yl-1-(2-pyrrolidin-1-ylethyl)urea;hydrochloride |
|---|---|
| PubChem CID | 146065182 |
| Molecular Formula | C20H33ClN4O |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3-(2-phenylethyl)-1-piperidin-3-yl-1-(2-pyrrolidin-1-ylethyl)urea;hydrochloride |
| SMILES | Cl.O=C(NCCc1ccccc1)N(CCN1CCCC1)C1CCCNC1 |
| InChI | InChI=1S/C20H32N4O.ClH/c25-20(22-12-10-18-7-2-1-3-8-18)24(19-9-6-11-21-17-19)16-15-23-13-4-5-14-23;/h1-3,7-8,19,21H,4-6,9-17H2,(H,22,25);1H |
| InChIKey | FAJDAQVJTFLLTI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |