C22H28N4O4 — CID 146068869
8-[2-(1H-indol-3-yl)acetyl]-2-(2-methoxyethyl)-6,6-dimethyl-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 146068869) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 8-[2-(1H-indol-3-yl)acetyl]-2-(2-methoxyethyl)-6,6-dimethyl-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 8-[2-(1H-indol-3-yl)acetyl]-2-(2-methoxyethyl)-6,6-dimethyl-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 146068869 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 8-[2-(1H-indol-3-yl)acetyl]-2-(2-methoxyethyl)-6,6-dimethyl-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | COCCN1C(=O)C2CN(C(=O)Cc3c[nH]c4ccccc34)CC(C)(C)CN2C1=O |
| InChI | InChI=1S/C22H28N4O4/c1-22(2)13-24(19(27)10-15-11-23-17-7-5-4-6-16(15)17)12-18-20(28)25(8-9-30-3)21(29)26(18)14-22/h4-7,11,18,23H,8-10,12-14H2,1-3H3 |
| InChIKey | ACPZDKQZPICPKY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|