C22H28N4O3 — CID 146068919
8-(1H-indole-4-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 146068919) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 8-(1H-indole-4-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 8-(1H-indole-4-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 146068919 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 8-(1H-indole-4-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | CC(C)CN1C(=O)C2CN(C(=O)c3cccc4[nH]ccc34)CC(C)(C)CN2C1=O |
| InChI | InChI=1S/C22H28N4O3/c1-14(2)10-25-20(28)18-11-24(12-22(3,4)13-26(18)21(25)29)19(27)16-6-5-7-17-15(16)8-9-23-17/h5-9,14,18,23H,10-13H2,1-4H3 |
| InChIKey | PEFFFOVCYMFXRR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|