C18H25N3O4 — CID 146068882
8-(furan-2-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 146068882) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 8-(furan-2-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 8-(furan-2-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 146068882 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 8-(furan-2-carbonyl)-6,6-dimethyl-2-(2-methylpropyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | CC(C)CN1C(=O)C2CN(C(=O)c3ccco3)CC(C)(C)CN2C1=O |
| InChI | InChI=1S/C18H25N3O4/c1-12(2)8-20-15(22)13-9-19(16(23)14-6-5-7-25-14)10-18(3,4)11-21(13)17(20)24/h5-7,12-13H,8-11H2,1-4H3 |
| InChIKey | VAXUEKHBSMFYAR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|