C26H41N7O2 — CID 146068942
(2S,3R,6S)-2-N-[(1-ethylpyrazol-4-yl)methyl]-6-N-methyl-5-(2-methylpropyl)-2-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-5-azaspiro[2.4]heptane-2,6-dicarboxamide (PubChem CID 146068942) has the molecular formula C26H41N7O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is (2S,3R,6S)-2-N-[(1-ethylpyrazol-4-yl)methyl]-6-N-methyl-5-(2-methylpropyl)-2-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-5-azaspiro[2.4]heptane-2,6-dicarboxamide.
| Compound Name | (2S,3R,6S)-2-N-[(1-ethylpyrazol-4-yl)methyl]-6-N-methyl-5-(2-methylpropyl)-2-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-5-azaspiro[2.4]heptane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 146068942 |
| Molecular Formula | C26H41N7O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | (2S,3R,6S)-2-N-[(1-ethylpyrazol-4-yl)methyl]-6-N-methyl-5-(2-methylpropyl)-2-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-5-azaspiro[2.4]heptane-2,6-dicarboxamide |
| SMILES | CCn1cc(CN(Cc2c(C)nn(C)c2C)C(=O)[C@H]2C[C@@]23C[C@@H](C(=O)NC)N(CC(C)C)C3)cn1 |
| InChI | InChI=1S/C26H41N7O2/c1-8-33-14-20(11-28-33)13-31(15-21-18(4)29-30(7)19(21)5)25(35)22-9-26(22)10-23(24(34)27-6)32(16-26)12-17(2)3/h11,14,17,22-23H,8-10,12-13,15-16H2,1-7H3,(H,27,34)/t22-,23+,26+/m1/s1 |
| InChIKey | UBNUWAJOHKEFEL-UMFSSWHCSA-N |
| XLogP | 2.26 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |