C27H33N5O2 — CID 146070070
(5aS,9aR)-1-methyl-7-[(1-propan-2-ylindol-3-yl)methyl]-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione (PubChem CID 146070070) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is (5aS,9aR)-1-methyl-7-[(1-propan-2-ylindol-3-yl)methyl]-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione.
| Compound Name | (5aS,9aR)-1-methyl-7-[(1-propan-2-ylindol-3-yl)methyl]-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione |
|---|---|
| PubChem CID | 146070070 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (5aS,9aR)-1-methyl-7-[(1-propan-2-ylindol-3-yl)methyl]-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione |
| SMILES | CC(C)n1cc(CN2CC[C@@H]3[C@H](C2)C(=O)N(Cc2cccnc2)CC(=O)N3C)c2ccccc21 |
| InChI | InChI=1S/C27H33N5O2/c1-19(2)32-16-21(22-8-4-5-9-25(22)32)15-30-12-10-24-23(17-30)27(34)31(18-26(33)29(24)3)14-20-7-6-11-28-13-20/h4-9,11,13,16,19,23-24H,10,12,14-15,17-18H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | PAXCCTLJDUJEGS-BJKOFHAPSA-N |
| XLogP | 3.31 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |