C20H24N4O3 — CID 146070067
(5aS,9aR)-7-(furan-3-ylmethyl)-1-methyl-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione (PubChem CID 146070067) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is (5aS,9aR)-7-(furan-3-ylmethyl)-1-methyl-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione.
| Compound Name | (5aS,9aR)-7-(furan-3-ylmethyl)-1-methyl-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione |
|---|---|
| PubChem CID | 146070067 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (5aS,9aR)-7-(furan-3-ylmethyl)-1-methyl-4-(pyridin-3-ylmethyl)-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione |
| SMILES | CN1C(=O)CN(Cc2cccnc2)C(=O)[C@H]2CN(Cc3ccoc3)CC[C@H]21 |
| InChI | InChI=1S/C20H24N4O3/c1-22-18-4-7-23(10-16-5-8-27-14-16)12-17(18)20(26)24(13-19(22)25)11-15-3-2-6-21-9-15/h2-3,5-6,8-9,14,17-18H,4,7,10-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | JBTQTGDOEAAHNM-ZWKOTPCHSA-N |
| XLogP | 1.37 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |