C28H28N4O4 — CID 146072805
methyl 3-[[(7-hex-5-ynoyl-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carbonyl)amino]methyl]benzoate (PubChem CID 146072805) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is methyl 3-[[(7-hex-5-ynoyl-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carbonyl)amino]methyl]benzoate.
| Compound Name | methyl 3-[[(7-hex-5-ynoyl-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carbonyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 146072805 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl 3-[[(7-hex-5-ynoyl-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carbonyl)amino]methyl]benzoate |
| SMILES | C#CCCCC(=O)N1CCn2cc(C(=O)NCc3cccc(C(=O)OC)c3)nc2C1c1ccccc1 |
| InChI | InChI=1S/C28H28N4O4/c1-3-4-6-14-24(33)32-16-15-31-19-23(30-26(31)25(32)21-11-7-5-8-12-21)27(34)29-18-20-10-9-13-22(17-20)28(35)36-2/h1,5,7-13,17,19,25H,4,6,14-16,18H2,2H3,(H,29,34) |
| InChIKey | BHLPFQJXFZQFRZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|