C27H28N4O3 — CID 146072806
7-hex-5-ynoyl-N-(2-phenoxyethyl)-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 146072806) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 7-hex-5-ynoyl-N-(2-phenoxyethyl)-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 7-hex-5-ynoyl-N-(2-phenoxyethyl)-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 146072806 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 7-hex-5-ynoyl-N-(2-phenoxyethyl)-8-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | C#CCCCC(=O)N1CCn2cc(C(=O)NCCOc3ccccc3)nc2C1c1ccccc1 |
| InChI | InChI=1S/C27H28N4O3/c1-2-3-6-15-24(32)31-18-17-30-20-23(29-26(30)25(31)21-11-7-4-8-12-21)27(33)28-16-19-34-22-13-9-5-10-14-22/h1,4-5,7-14,20,25H,3,6,15-19H2,(H,28,33) |
| InChIKey | VYHLZTOLEFVAEL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|