C16H27N5O4S — CID 146072984
1-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-3-(2-methylpropyl)urea (PubChem CID 146072984) has the molecular formula C16H27N5O4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 146072984 |
| Molecular Formula | C16H27N5O4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-3-(2-methylpropyl)urea |
| SMILES | Cc1noc([C@]23C[C@H](NC(=O)NCC(C)C)C[C@H]2CN(S(C)(=O)=O)C3)n1 |
| InChI | InChI=1S/C16H27N5O4S/c1-10(2)7-17-15(22)19-13-5-12-8-21(26(4,23)24)9-16(12,6-13)14-18-11(3)20-25-14/h10,12-13H,5-9H2,1-4H3,(H2,17,19,22)/t12-,13+,16-/m0/s1 |
| InChIKey | BVWOSJBTTYBQOQ-ZENOOKHLSA-N |
| XLogP | 0.62 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |