C17H24N4O4S — CID 146073082
N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]cyclopent-3-ene-1-carboxamide (PubChem CID 146073082) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 146073082 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-methylsulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]cyclopent-3-ene-1-carboxamide |
| SMILES | Cc1noc([C@]23C[C@H](NC(=O)C4CC=CC4)C[C@H]2CN(S(C)(=O)=O)C3)n1 |
| InChI | InChI=1S/C17H24N4O4S/c1-11-18-16(25-20-11)17-8-14(19-15(22)12-5-3-4-6-12)7-13(17)9-21(10-17)26(2,23)24/h3-4,12-14H,5-10H2,1-2H3,(H,19,22)/t13-,14+,17-/m0/s1 |
| InChIKey | ZTWWEOKYULTYHQ-VBQJREDUSA-N |
| XLogP | 0.75 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|