C22H28N4O5 — CID 146072889
N-[(3aR,5R,6aR)-2-(2-methoxyacetyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(4-methoxyphenyl)acetamide (PubChem CID 146072889) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(3aR,5R,6aR)-2-(2-methoxyacetyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(3aR,5R,6aR)-2-(2-methoxyacetyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 146072889 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[(3aR,5R,6aR)-2-(2-methoxyacetyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COCC(=O)N1C[C@@H]2C[C@@H](NC(=O)Cc3ccc(OC)cc3)C[C@]2(c2nc(C)no2)C1 |
| InChI | InChI=1S/C22H28N4O5/c1-14-23-21(31-25-14)22-10-17(9-16(22)11-26(13-22)20(28)12-29-2)24-19(27)8-15-4-6-18(30-3)7-5-15/h4-7,16-17H,8-13H2,1-3H3,(H,24,27)/t16-,17+,22-/m0/s1 |
| InChIKey | JBWAWZOKYPNHLC-JKSBSHDWSA-N |
| XLogP | 1.25 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |