C19H26N6O3 — CID 171142753
N-[3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 171142753) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171142753 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cc1noc(C23CC(NC(=O)c4ccn(C)n4)CC2CN(C(=O)C(C)C)C3)n1 |
| InChI | InChI=1S/C19H26N6O3/c1-11(2)17(27)25-9-13-7-14(21-16(26)15-5-6-24(4)22-15)8-19(13,10-25)18-20-12(3)23-28-18/h5-6,11,13-14H,7-10H2,1-4H3,(H,21,26) |
| InChIKey | USYQWYUXTNVGHF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |